C17H17F3N6O2S — CID 25095930
4-methyl-2-[5-oxo-1-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 25095930) has the molecular formula C17H17F3N6O2S and a molecular weight of 426.42 g/mol. Its IUPAC name is 4-methyl-2-[5-oxo-1-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-[5-oxo-1-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 25095930 |
| Molecular Formula | C17H17F3N6O2S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-methyl-2-[5-oxo-1-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-n2cnn(CCCC(F)(F)F)c2=O)sc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C17H17F3N6O2S/c1-11-13(14(27)22-9-12-4-2-6-21-8-12)29-15(24-11)25-10-23-26(16(25)28)7-3-5-17(18,19)20/h2,4,6,8,10H,3,5,7,9H2,1H3,(H,22,27) |
| InChIKey | VJVXNAFSDHYZBV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |