C34H42FN3O4 — CID 25096597
methyl N-[4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate (PubChem CID 25096597) has the molecular formula C34H42FN3O4 and a molecular weight of 575.73 g/mol. Its IUPAC name is methyl N-[4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 25096597 |
| Molecular Formula | C34H42FN3O4 |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | methyl N-[4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamate |
| SMILES | CCc1cccc(-c2c(F)cccc2C(O)(CCCNC(=O)OC)[C@@H]2CCCN(C(=O)c3ccc(CNC)cc3)C2)c1 |
| InChI | InChI=1S/C34H42FN3O4/c1-4-24-9-5-10-27(21-24)31-29(12-6-13-30(31)35)34(41,18-8-19-37-33(40)42-3)28-11-7-20-38(23-28)32(39)26-16-14-25(15-17-26)22-36-2/h5-6,9-10,12-17,21,28,36,41H,4,7-8,11,18-20,22-23H2,1-3H3,(H,37,40)/t28-,34?/m1/s1 |
| InChIKey | RCBNOCBOHBFXIL-JSAORFSISA-N |
| XLogP | 5.65 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|