C25H21F6N3O3 — CID 25096718
1,1,1,3,3,3-hexafluoropropan-2-yl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 25096718) has the molecular formula C25H21F6N3O3 and a molecular weight of 525.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 25096718 |
| Molecular Formula | C25H21F6N3O3 |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Cc1nc2c(c(=O)n1C(c1ccccc1)c1ccccc1)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C25H21F6N3O3/c1-15-32-19-14-33(23(36)37-22(24(26,27)28)25(29,30)31)13-12-18(19)21(35)34(15)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,20,22H,12-14H2,1H3 |
| InChIKey | QRIAAJZDGRYEFY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |