C17H14Cl3F3N2O3S — CID 25096878
N-[4-chloro-2-[(E)-N-[(3,4-dichlorophenyl)methoxy]-C-ethylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 25096878) has the molecular formula C17H14Cl3F3N2O3S and a molecular weight of 489.73 g/mol. Its IUPAC name is N-[4-chloro-2-[(E)-N-[(3,4-dichlorophenyl)methoxy]-C-ethylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-chloro-2-[(E)-N-[(3,4-dichlorophenyl)methoxy]-C-ethylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 25096878 |
| Molecular Formula | C17H14Cl3F3N2O3S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | N-[4-chloro-2-[(E)-N-[(3,4-dichlorophenyl)methoxy]-C-ethylcarbonimidoyl]phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC/C(=N\OCc1ccc(Cl)c(Cl)c1)c1cc(Cl)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H14Cl3F3N2O3S/c1-2-15(24-28-9-10-3-5-13(19)14(20)7-10)12-8-11(18)4-6-16(12)25-29(26,27)17(21,22)23/h3-8,25H,2,9H2,1H3/b24-15+ |
| InChIKey | XICHYAWEIICOGX-BUVRLJJBSA-N |
| XLogP | 6.24 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|