C25H22F5N3O3 — CID 25096965
2,2,3,3,3-pentafluoropropyl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 25096965) has the molecular formula C25H22F5N3O3 and a molecular weight of 507.46 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 25096965 |
| Molecular Formula | C25H22F5N3O3 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 3-benzhydryl-2-methyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Cc1nc2c(c(=O)n1C(c1ccccc1)c1ccccc1)CCN(C(=O)OCC(F)(F)C(F)(F)F)C2 |
| InChI | InChI=1S/C25H22F5N3O3/c1-16-31-20-14-32(23(35)36-15-24(26,27)25(28,29)30)13-12-19(20)22(34)33(16)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,21H,12-15H2,1H3 |
| InChIKey | NDVIDCWXBLEVNJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|