C34H35ClF6N2O4 — CID 25097097
N-[4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]acetamide (PubChem CID 25097097) has the molecular formula C34H35ClF6N2O4 and a molecular weight of 685.11 g/mol. Its IUPAC name is N-[4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]acetamide.
| Compound Name | N-[4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]acetamide |
|---|---|
| PubChem CID | 25097097 |
| Molecular Formula | C34H35ClF6N2O4 |
| Molecular Weight | 685.11 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | N-[4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]acetamide |
| SMILES | CC(=O)NCCCC(O)(c1cccc(Cl)c1-c1cccc(C)c1)[C@@H]1CCCN(C(=O)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C34H35ClF6N2O4/c1-21-7-3-8-24(19-21)29-27(10-4-11-28(29)35)31(46,16-6-17-42-22(2)44)26-9-5-18-43(20-26)30(45)23-12-14-25(15-13-23)32(47,33(36,37)38)34(39,40)41/h3-4,7-8,10-15,19,26,46-47H,5-6,9,16-18,20H2,1-2H3,(H,42,44)/t26-,31?/m1/s1 |
| InChIKey | XJUQUBVCUQZEDE-SYQKMTEESA-N |
| XLogP | 7.28 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.11 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|