C25H20F6N4O3 — CID 25097211
(2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[bis(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 25097211) has the molecular formula C25H20F6N4O3 and a molecular weight of 538.45 g/mol. Its IUPAC name is (2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[bis(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | (2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[bis(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 25097211 |
| Molecular Formula | C25H20F6N4O3 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | (2,2,3,3-tetrafluorocyclobutyl) 2-amino-3-[bis(4-fluorophenyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Nc1nc2c(c(=O)n1C(c1ccc(F)cc1)c1ccc(F)cc1)CCN(C(=O)OC1CC(F)(F)C1(F)F)C2 |
| InChI | InChI=1S/C25H20F6N4O3/c26-15-5-1-13(2-6-15)20(14-3-7-16(27)8-4-14)35-21(36)17-9-10-34(12-18(17)33-22(35)32)23(37)38-19-11-24(28,29)25(19,30)31/h1-8,19-20H,9-12H2,(H2,32,33) |
| InChIKey | FVAKUDIGBCLDGK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|