C38H47ClF3N3O6 — CID 25097340
[4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]phenyl]methyl-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 25097340) has the molecular formula C38H47ClF3N3O6 and a molecular weight of 734.26 g/mol. Its IUPAC name is [4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]phenyl]methyl-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]phenyl]methyl-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 25097340 |
| Molecular Formula | C38H47ClF3N3O6 |
| Molecular Weight | 734.26 g/mol |
| Exact Mass | 733.31 |
| IUPAC Name | [4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]phenyl]methyl-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)OC)C2CCCN(C(=O)c3ccc(C[N+](C)(C)C)cc3)C2)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C36H46ClN3O4.C2HF3O2/c1-6-26-11-7-12-29(23-26)33-31(14-8-15-32(33)37)36(43,20-10-21-38-35(42)44-5)30-13-9-22-39(24-30)34(41)28-18-16-27(17-19-28)25-40(2,3)4;3-2(4,5)1(6)7/h7-8,11-12,14-19,23,30,43H,6,9-10,13,20-22,24-25H2,1-5H3;(H,6,7) |
| InChIKey | RJRAIANMNPVQJA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|