C31H38N4O8S2 — CID 25097372
N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[(2R)-2-methylbutyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 25097372) has the molecular formula C31H38N4O8S2 and a molecular weight of 658.80 g/mol. Its IUPAC name is N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[(2R)-2-methylbutyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[(2R)-2-methylbutyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 25097372 |
| Molecular Formula | C31H38N4O8S2 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[(2R)-2-methylbutyl]amino]-3-hydroxy-1-phenylbutan-2-yl]-3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | CC[C@@H](C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)C1CN(c2sc(C)nc2C)C(=O)O1)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H38N4O8S2/c1-5-19(2)15-34(45(39,40)23-11-12-26-27(14-23)42-18-41-26)16-25(36)24(13-22-9-7-6-8-10-22)33-29(37)28-17-35(31(38)43-28)30-20(3)32-21(4)44-30/h6-12,14,19,24-25,28,36H,5,13,15-18H2,1-4H3,(H,33,37)/t19-,24+,25-,28?/m1/s1 |
| InChIKey | GZVLBMZFZHCLDY-BEYXCHBSSA-N |
| XLogP | 3.64 |
| TPSA | 147.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |