C24H20F6N4O3 — CID 25097466
1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-benzhydryl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 25097466) has the molecular formula C24H20F6N4O3 and a molecular weight of 526.44 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-benzhydryl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-benzhydryl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 25097466 |
| Molecular Formula | C24H20F6N4O3 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-benzhydryl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Nc1nc2c(c(=O)n1C(c1ccccc1)c1ccccc1)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C24H20F6N4O3/c25-23(26,27)20(24(28,29)30)37-22(36)33-12-11-16-17(13-33)32-21(31)34(19(16)35)18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,18,20H,11-13H2,(H2,31,32) |
| InChIKey | XPWLQEAQDDNWJF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |