C20H26F3NO5 — CID 25097649
(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-8,8,8-trifluoro-7-oxooctanoic acid (PubChem CID 25097649) has the molecular formula C20H26F3NO5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-8,8,8-trifluoro-7-oxooctanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-8,8,8-trifluoro-7-oxooctanoic acid |
|---|---|
| PubChem CID | 25097649 |
| Molecular Formula | C20H26F3NO5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-8,8,8-trifluoro-7-oxooctanoic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](CCCCC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H26F3NO5/c1-2-29-19(28)16(13-12-14-8-4-3-5-9-14)24-15(18(26)27)10-6-7-11-17(25)20(21,22)23/h3-5,8-9,15-16,24H,2,6-7,10-13H2,1H3,(H,26,27)/t15-,16-/m0/s1 |
| InChIKey | LEZMLEYTYQRQIK-HOTGVXAUSA-N |
| XLogP | 3.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|