C13H9F3N4O — CID 25097797
6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one (PubChem CID 25097797) has the molecular formula C13H9F3N4O and a molecular weight of 294.24 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one.
| Compound Name | 6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25097797 |
| Molecular Formula | C13H9F3N4O |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2nc(NCC(F)(F)F)c3ccncc3c12 |
| InChI | InChI=1S/C13H9F3N4O/c14-13(15,16)6-19-11-7-1-3-17-5-8(7)10-9(20-11)2-4-18-12(10)21/h1-5H,6H2,(H,18,21)(H,19,20) |
| InChIKey | FVEDKTZRULIYGR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|