C19H15ClFNO3S — CID 25098085
4-(4-chloro-2-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide (PubChem CID 25098085) has the molecular formula C19H15ClFNO3S and a molecular weight of 391.85 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-(4-chloro-2-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25098085 |
| Molecular Formula | C19H15ClFNO3S |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CO)c1)c1ccc(-c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H15ClFNO3S/c20-15-6-9-18(19(21)11-15)14-4-7-17(8-5-14)26(24,25)22-16-3-1-2-13(10-16)12-23/h1-11,22-23H,12H2 |
| InChIKey | XOGMVMSNSCCFPN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |