About 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate (PubChem CID 25098511) has the molecular formula C21H19FN2O2S2
and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate.
Molecular Properties
| Compound Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate |
| PubChem CID | 25098511 |
| Molecular Formula | C21H19FN2O2S2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate |
| SMILES | O=C(OCCNC(=S)NC1CCc2c(F)cccc21)c1ccc2sccc2c1 |
| InChI | InChI=1S/C21H19FN2O2S2/c22-17-3-1-2-16-15(17)5-6-18(16)24-21(27)23-9-10-26-20(25)14-4-7-19-13(12-14)8-11-28-19/h1-4,7-8,11-12,18H,5-6,9-10H2,(H2,23,24,27) |
| InChIKey | NXCZTKDTHKDYQM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate?
The IUPAC name of 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate (CID 25098511) is 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate.
What is the SMILES notation for 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate?
The canonical SMILES for 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate is O=C(OCCNC(=S)NC1CCc2c(F)cccc21)c1ccc2sccc2c1.
What is the InChIKey of 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate?
The InChIKey is NXCZTKDTHKDYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O2S2/c22-17-3-1-2-16-15(17)5-6-18(16)24-21(27)23-9-10-26-20(25)14-4-7-19-13(12-14)8-11-28-19/h1-4,7-8,11-12,18H,5-6,9-10H2,(H2,23,24,27).
What are the key properties of 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate?
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate has a molecular weight of 414.53 g/mol, XLogP of 4.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 1-benzothiophene-5-carboxylate is sourced from PubChem (CID 25098511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).