C30H45N5O4S — CID 25098786
(3S,4aS,8aS)-2-[(2R)-3-[(3-aminophenyl)methyl-(4-aminophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 25098786) has the molecular formula C30H45N5O4S and a molecular weight of 571.79 g/mol. Its IUPAC name is (3S,4aS,8aS)-2-[(2R)-3-[(3-aminophenyl)methyl-(4-aminophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S,4aS,8aS)-2-[(2R)-3-[(3-aminophenyl)methyl-(4-aminophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 25098786 |
| Molecular Formula | C30H45N5O4S |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | (3S,4aS,8aS)-2-[(2R)-3-[(3-aminophenyl)methyl-(4-aminophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C[C@@H](O)CN(Cc1cccc(N)c1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H45N5O4S/c1-30(2,3)33-29(37)28-16-22-8-4-5-9-23(22)18-34(28)19-26(36)20-35(17-21-7-6-10-25(32)15-21)40(38,39)27-13-11-24(31)12-14-27/h6-7,10-15,22-23,26,28,36H,4-5,8-9,16-20,31-32H2,1-3H3,(H,33,37)/t22-,23+,26+,28-/m0/s1 |
| InChIKey | MYSUTPWSABQSCK-WMSJLGCSSA-N |
| XLogP | 3.20 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|