About 4-hydroxyhex-5-enyl acetate
4-hydroxyhex-5-enyl acetate (PubChem CID 25098807) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-hydroxyhex-5-enyl acetate.
Molecular Properties
| Compound Name | 4-hydroxyhex-5-enyl acetate |
| PubChem CID | 25098807 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 4-hydroxyhex-5-enyl acetate |
| SMILES | C=CC(O)CCCOC(C)=O |
| InChI | InChI=1S/C8H14O3/c1-3-8(10)5-4-6-11-7(2)9/h3,8,10H,1,4-6H2,2H3 |
| InChIKey | HOMZMDSQBKHSOC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyhex-5-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyhex-5-enyl acetate?
The IUPAC name of 4-hydroxyhex-5-enyl acetate (CID 25098807) is 4-hydroxyhex-5-enyl acetate.
What is the SMILES notation for 4-hydroxyhex-5-enyl acetate?
The canonical SMILES for 4-hydroxyhex-5-enyl acetate is C=CC(O)CCCOC(C)=O.
What is the InChIKey of 4-hydroxyhex-5-enyl acetate?
The InChIKey is HOMZMDSQBKHSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-8(10)5-4-6-11-7(2)9/h3,8,10H,1,4-6H2,2H3.
What are the key properties of 4-hydroxyhex-5-enyl acetate?
4-hydroxyhex-5-enyl acetate has a molecular weight of 158.20 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyhex-5-enyl acetate is sourced from PubChem (CID 25098807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).