C31H42N4O8S — CID 25098824
(3S,4aS,8aS)-2-[(2R)-3-[1,3-benzodioxol-5-ylmethyl-(4-nitrophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 25098824) has the molecular formula C31H42N4O8S and a molecular weight of 630.76 g/mol. Its IUPAC name is (3S,4aS,8aS)-2-[(2R)-3-[1,3-benzodioxol-5-ylmethyl-(4-nitrophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S,4aS,8aS)-2-[(2R)-3-[1,3-benzodioxol-5-ylmethyl-(4-nitrophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 25098824 |
| Molecular Formula | C31H42N4O8S |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | (3S,4aS,8aS)-2-[(2R)-3-[1,3-benzodioxol-5-ylmethyl-(4-nitrophenyl)sulfonylamino]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C[C@@H](O)CN(Cc1ccc2c(c1)OCO2)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H42N4O8S/c1-31(2,3)32-30(37)27-15-22-6-4-5-7-23(22)17-33(27)18-25(36)19-34(16-21-8-13-28-29(14-21)43-20-42-28)44(40,41)26-11-9-24(10-12-26)35(38)39/h8-14,22-23,25,27,36H,4-7,15-20H2,1-3H3,(H,32,37)/t22-,23+,25+,27-/m0/s1 |
| InChIKey | OMQFMUKKJYQBQS-UUNMANHLSA-N |
| XLogP | 3.67 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|