C31H56O6Si — CID 25098863
(2E,4Z,7S,12E,17R)-17-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-1-(oxan-2-yloxy)octadeca-2,4,12-trien-9-one (PubChem CID 25098863) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is (2E,4Z,7S,12E,17R)-17-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-1-(oxan-2-yloxy)octadeca-2,4,12-trien-9-one.
| Compound Name | (2E,4Z,7S,12E,17R)-17-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-1-(oxan-2-yloxy)octadeca-2,4,12-trien-9-one |
|---|---|
| PubChem CID | 25098863 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (2E,4Z,7S,12E,17R)-17-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-1-(oxan-2-yloxy)octadeca-2,4,12-trien-9-one |
| SMILES | COCO[C@@H](C/C=C\C=C\COC1CCCCO1)CC(=O)CC/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56O6Si/c1-27(37-38(6,7)31(2,3)4)19-13-9-8-10-14-20-28(32)25-29(36-26-33-5)21-15-11-12-17-23-34-30-22-16-18-24-35-30/h8,10-12,15,17,27,29-30H,9,13-14,16,18-26H2,1-7H3/b10-8+,15-11-,17-12+/t27-,29+,30?/m1/s1 |
| InChIKey | MHDMXNWKQUKUEY-HFNFTRJQSA-N |
| XLogP | 7.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|