About tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate
tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 25098986) has the molecular formula C17H29NO3
and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate |
| PubChem CID | 25098986 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCC/C=C/[C@H](C=O)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO3/c1-5-6-7-8-10-14(13-19)15-11-9-12-18(15)16(20)21-17(2,3)4/h8,10,13-15H,5-7,9,11-12H2,1-4H3/b10-8+/t14-,15-/m1/s1 |
| InChIKey | UPSLIJYCIYCXGD-QSTFCLMHSA-N |
| XLogP | 3.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate (CID 25098986) is tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate is CCCC/C=C/[C@H](C=O)[C@H]1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate?
The InChIKey is UPSLIJYCIYCXGD-QSTFCLMHSA-N. The full InChI is InChI=1S/C17H29NO3/c1-5-6-7-8-10-14(13-19)15-11-9-12-18(15)16(20)21-17(2,3)4/h8,10,13-15H,5-7,9,11-12H2,1-4H3/b10-8+/t14-,15-/m1/s1.
What are the key properties of tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate?
tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate has a molecular weight of 295.42 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-[(E,2S)-1-oxooct-3-en-2-yl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 25098986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).