C40H46N4O2 — CID 25099023
4-[(1R,2R)-1,2-bis[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-(6-methoxyquinolin-4-yl)ethyl]-6-methoxyquinoline (PubChem CID 25099023) has the molecular formula C40H46N4O2 and a molecular weight of 614.83 g/mol. Its IUPAC name is 4-[(1R,2R)-1,2-bis[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-(6-methoxyquinolin-4-yl)ethyl]-6-methoxyquinoline.
| Compound Name | 4-[(1R,2R)-1,2-bis[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-(6-methoxyquinolin-4-yl)ethyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 25099023 |
| Molecular Formula | C40H46N4O2 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | 4-[(1R,2R)-1,2-bis[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-(6-methoxyquinolin-4-yl)ethyl]-6-methoxyquinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c1ccnc2ccc(OC)cc12)[C@H](c1ccnc2ccc(OC)cc12)[C@@H]1C[C@@H]2CCN1C[C@@H]2C=C |
| InChI | InChI=1S/C40H46N4O2/c1-5-25-23-43-17-13-27(25)19-37(43)39(31-11-15-41-35-9-7-29(45-3)21-33(31)35)40(38-20-28-14-18-44(38)24-26(28)6-2)32-12-16-42-36-10-8-30(46-4)22-34(32)36/h5-12,15-16,21-22,25-28,37-40H,1-2,13-14,17-20,23-24H2,3-4H3/t25-,26-,27-,28-,37-,38-,39+,40+/m0/s1 |
| InChIKey | DTWUYAWUJZLGBV-OGBHYEAZSA-N |
| XLogP | 7.46 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|