C19H23N5O2 — CID 25099170
6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-ethylquinazoline-2,4,6-triamine (PubChem CID 25099170) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-ethylquinazoline-2,4,6-triamine.
| Compound Name | 6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-ethylquinazoline-2,4,6-triamine |
|---|---|
| PubChem CID | 25099170 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-ethylquinazoline-2,4,6-triamine |
| SMILES | CCN(Cc1cc(OC)ccc1OC)c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C19H23N5O2/c1-4-24(11-12-9-14(25-2)6-8-17(12)26-3)13-5-7-16-15(10-13)18(20)23-19(21)22-16/h5-10H,4,11H2,1-3H3,(H4,20,21,22,23) |
| InChIKey | ZDKAQGINSFSQDO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |