About 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine
5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine (PubChem CID 25099412) has the molecular formula C14H16ClN3
and a molecular weight of 261.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine |
| PubChem CID | 25099412 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine |
| SMILES | CCc1nc(N)nc(CC)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN3/c1-3-11-13(9-5-7-10(15)8-6-9)12(4-2)18-14(16)17-11/h5-8H,3-4H2,1-2H3,(H2,16,17,18) |
| InChIKey | XGZBSMCYTULAMJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine?
The IUPAC name of 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine (CID 25099412) is 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine.
What is the SMILES notation for 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine?
The canonical SMILES for 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine is CCc1nc(N)nc(CC)c1-c1ccc(Cl)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine?
The InChIKey is XGZBSMCYTULAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3/c1-3-11-13(9-5-7-10(15)8-6-9)12(4-2)18-14(16)17-11/h5-8H,3-4H2,1-2H3,(H2,16,17,18).
What are the key properties of 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine?
5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine has a molecular weight of 261.76 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-4,6-diethylpyrimidin-2-amine is sourced from PubChem (CID 25099412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).