C17H22F3NO2 — CID 25100233
1,3-dibutyl-2-nitro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 25100233) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 1,3-dibutyl-2-nitro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 1,3-dibutyl-2-nitro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 25100233 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1,3-dibutyl-2-nitro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | C=C(c1cc(CCCC)c([N+](=O)[O-])c(CCCC)c1)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO2/c1-4-6-8-13-10-15(12(3)17(18,19)20)11-14(9-7-5-2)16(13)21(22)23/h10-11H,3-9H2,1-2H3 |
| InChIKey | GNWZRVIAMGVHFG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|