C32H38ClFN2O3 — CID 25100683
[(4R)-4-chloro-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)cyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone (PubChem CID 25100683) has the molecular formula C32H38ClFN2O3 and a molecular weight of 553.12 g/mol. Its IUPAC name is [(4R)-4-chloro-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)cyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone.
| Compound Name | [(4R)-4-chloro-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)cyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 25100683 |
| Molecular Formula | C32H38ClFN2O3 |
| Molecular Weight | 553.12 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [(4R)-4-chloro-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)cyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone |
| SMILES | Cc1c(F)cccc1[C@]1(Cl)C=CC(CCCCN(C)C)(C(=O)[C@H]2CCCNC2)C=C1C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C32H38ClFN2O3/c1-22-26(12-7-13-28(22)34)32(33)16-15-31(14-4-5-18-36(2)3,30(39)24-10-8-17-35-21-24)20-27(32)29(38)23-9-6-11-25(37)19-23/h6-7,9,11-13,15-16,19-20,24,35,37H,4-5,8,10,14,17-18,21H2,1-3H3/t24-,31?,32+/m0/s1 |
| InChIKey | ZZTFREOZJRONBK-OSJVCQNFSA-N |
| XLogP | 5.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.12 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|