C33H41FN2O3 — CID 25100837
[(4R)-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)-4-methylcyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone (PubChem CID 25100837) has the molecular formula C33H41FN2O3 and a molecular weight of 532.70 g/mol. Its IUPAC name is [(4R)-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)-4-methylcyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone.
| Compound Name | [(4R)-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)-4-methylcyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 25100837 |
| Molecular Formula | C33H41FN2O3 |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | [(4R)-1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-3-(3-hydroxybenzoyl)-4-methylcyclohexa-2,5-dien-1-yl]-[(3S)-piperidin-3-yl]methanone |
| SMILES | Cc1c(F)cccc1[C@@]1(C)C=CC(CCCCN(C)C)(C(=O)[C@H]2CCCNC2)C=C1C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C33H41FN2O3/c1-23-27(13-8-14-29(23)34)32(2)16-17-33(15-5-6-19-36(3)4,31(39)25-11-9-18-35-22-25)21-28(32)30(38)24-10-7-12-26(37)20-24/h7-8,10,12-14,16-17,20-21,25,35,37H,5-6,9,11,15,18-19,22H2,1-4H3/t25-,32+,33?/m0/s1 |
| InChIKey | ZTWHFQKOYNKKEN-XNIVWIEASA-N |
| XLogP | 5.76 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|