C29H22F3NO3 — CID 25100894
1-(3-naphthalen-1-yloxypropyl)-3-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid (PubChem CID 25100894) has the molecular formula C29H22F3NO3 and a molecular weight of 489.49 g/mol. Its IUPAC name is 1-(3-naphthalen-1-yloxypropyl)-3-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid.
| Compound Name | 1-(3-naphthalen-1-yloxypropyl)-3-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25100894 |
| Molecular Formula | C29H22F3NO3 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-(3-naphthalen-1-yloxypropyl)-3-[2-(trifluoromethyl)phenyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2C(F)(F)F)c2ccccc2n1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C29H22F3NO3/c30-29(31,32)23-14-5-3-12-21(23)26-22-13-4-6-15-24(22)33(27(26)28(34)35)17-8-18-36-25-16-7-10-19-9-1-2-11-20(19)25/h1-7,9-16H,8,17-18H2,(H,34,35) |
| InChIKey | MOIINNOLRVDNQW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|