C24H29ClN4O — CID 25101001
4-chloro-N-[2-cyclohexyl-6-(diethylamino)-3H-benzimidazol-5-yl]benzamide (PubChem CID 25101001) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is 4-chloro-N-[2-cyclohexyl-6-(diethylamino)-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-cyclohexyl-6-(diethylamino)-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 25101001 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-chloro-N-[2-cyclohexyl-6-(diethylamino)-3H-benzimidazol-5-yl]benzamide |
| SMILES | CCN(CC)c1cc2nc(C3CCCCC3)[nH]c2cc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29ClN4O/c1-3-29(4-2)22-15-20-19(26-23(27-20)16-8-6-5-7-9-16)14-21(22)28-24(30)17-10-12-18(25)13-11-17/h10-16H,3-9H2,1-2H3,(H,26,27)(H,28,30) |
| InChIKey | NZPFXNAUXZOPOQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |