About 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine
4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 25101047) has the molecular formula C15H12N4O2S
and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine |
| PubChem CID | 25101047 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C15H12N4O2S/c16-11-3-5-12(6-4-11)17-15-18-14(9-22-15)10-1-7-13(8-2-10)19(20)21/h1-9H,16H2,(H,17,18) |
| InChIKey | UGPJXLDHTGOAHL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine?
The IUPAC name of 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine (CID 25101047) is 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine.
What is the SMILES notation for 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine?
The canonical SMILES for 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine is Nc1ccc(Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1.
What is the InChIKey of 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine?
The InChIKey is UGPJXLDHTGOAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2S/c16-11-3-5-12(6-4-11)17-15-18-14(9-22-15)10-1-7-13(8-2-10)19(20)21/h1-9H,16H2,(H,17,18).
What are the key properties of 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine?
4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine has a molecular weight of 312.35 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine is sourced from PubChem (CID 25101047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).