C15H11Cl2N3S — CID 25101050
4-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 25101050) has the molecular formula C15H11Cl2N3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 4-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 25101050 |
| Molecular Formula | C15H11Cl2N3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 4-N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc(-c3cc(Cl)ccc3Cl)cs2)cc1 |
| InChI | InChI=1S/C15H11Cl2N3S/c16-9-1-6-13(17)12(7-9)14-8-21-15(20-14)19-11-4-2-10(18)3-5-11/h1-8H,18H2,(H,19,20) |
| InChIKey | VCPAAINVTYMTKR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|