About 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine
3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine (PubChem CID 25101185) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine |
| PubChem CID | 25101185 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1cccc(/C=C/c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C20H25N/c1-16-7-4-8-17(2)20(16)13-12-19-10-5-9-18(15-19)11-6-14-21-3/h4-5,7-10,12-13,15,21H,6,11,14H2,1-3H3/b13-12+ |
| InChIKey | ZAIOJCJMZKCELI-OUKQBFOZSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine?
The IUPAC name of 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine (CID 25101185) is 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine.
What is the SMILES notation for 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine?
The canonical SMILES for 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine is CNCCCc1cccc(/C=C/c2c(C)cccc2C)c1.
What is the InChIKey of 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine?
The InChIKey is ZAIOJCJMZKCELI-OUKQBFOZSA-N. The full InChI is InChI=1S/C20H25N/c1-16-7-4-8-17(2)20(16)13-12-19-10-5-9-18(15-19)11-6-14-21-3/h4-5,7-10,12-13,15,21H,6,11,14H2,1-3H3/b13-12+.
What are the key properties of 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine?
3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine has a molecular weight of 279.43 g/mol, XLogP of 4.63, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(E)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-N-methylpropan-1-amine is sourced from PubChem (CID 25101185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).