C22H16FN3 — CID 25101816
3-(4-fluorophenyl)-5-methyl-1-prop-2-ynyl-2-pyridin-4-ylpyrrolo[3,2-b]pyridine (PubChem CID 25101816) has the molecular formula C22H16FN3 and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-methyl-1-prop-2-ynyl-2-pyridin-4-ylpyrrolo[3,2-b]pyridine.
| Compound Name | 3-(4-fluorophenyl)-5-methyl-1-prop-2-ynyl-2-pyridin-4-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 25101816 |
| Molecular Formula | C22H16FN3 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-(4-fluorophenyl)-5-methyl-1-prop-2-ynyl-2-pyridin-4-ylpyrrolo[3,2-b]pyridine |
| SMILES | C#CCn1c(-c2ccncc2)c(-c2ccc(F)cc2)c2nc(C)ccc21 |
| InChI | InChI=1S/C22H16FN3/c1-3-14-26-19-9-4-15(2)25-21(19)20(16-5-7-18(23)8-6-16)22(26)17-10-12-24-13-11-17/h1,4-13H,14H2,2H3 |
| InChIKey | UNZBRBBHURDNFG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|