C20H22F2N6 — CID 25102180
4-N-(5-aminopentyl)-2-N,6-bis(3-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 25102180) has the molecular formula C20H22F2N6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-N-(5-aminopentyl)-2-N,6-bis(3-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(5-aminopentyl)-2-N,6-bis(3-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25102180 |
| Molecular Formula | C20H22F2N6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-N-(5-aminopentyl)-2-N,6-bis(3-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | NCCCCCNc1nc(Nc2cccc(F)c2)nc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H22F2N6/c21-15-7-4-6-14(12-15)18-26-19(24-11-3-1-2-10-23)28-20(27-18)25-17-9-5-8-16(22)13-17/h4-9,12-13H,1-3,10-11,23H2,(H2,24,25,26,27,28) |
| InChIKey | NJKACHMBWJJYDA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|