C23H22N2O5 — CID 25102449
ethyl (2R,11R,12S,13R)-13-methyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate (PubChem CID 25102449) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl (2R,11R,12S,13R)-13-methyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate.
| Compound Name | ethyl (2R,11R,12S,13R)-13-methyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 25102449 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | ethyl (2R,11R,12S,13R)-13-methyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2COc3ccccc3[C@@H]2N2C(=O)c3ccccc3NC(=O)[C@@]12C |
| InChI | InChI=1S/C23H22N2O5/c1-3-29-21(27)18-15-12-30-17-11-7-5-9-14(17)19(15)25-20(26)13-8-4-6-10-16(13)24-22(28)23(18,25)2/h4-11,15,18-19H,3,12H2,1-2H3,(H,24,28)/t15-,18-,19+,23-/m1/s1 |
| InChIKey | XJWGLLSOAZGSSZ-JYISGYRJSA-N |
| XLogP | 2.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |