C25H26N2O5 — CID 25102484
ethyl (2R,11R,12S,13R)-13,18,20-trimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate (PubChem CID 25102484) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is ethyl (2R,11R,12S,13R)-13,18,20-trimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate.
| Compound Name | ethyl (2R,11R,12S,13R)-13,18,20-trimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 25102484 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | ethyl (2R,11R,12S,13R)-13,18,20-trimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16,18,20-hexaene-12-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2COc3ccccc3[C@@H]2N2C(=O)c3c(C)cc(C)cc3NC(=O)[C@@]12C |
| InChI | InChI=1S/C25H26N2O5/c1-5-31-23(29)20-16-12-32-18-9-7-6-8-15(18)21(16)27-22(28)19-14(3)10-13(2)11-17(19)26-24(30)25(20,27)4/h6-11,16,20-21H,5,12H2,1-4H3,(H,26,30)/t16-,20-,21+,25-/m1/s1 |
| InChIKey | JWCQCMTTWKYWRC-IJUKNHKESA-N |
| XLogP | 3.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |