About (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine
(5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine (PubChem CID 25102539) has the molecular formula C20H31N3
and a molecular weight of 313.49 g/mol. Its IUPAC name is (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 25102539 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine |
| SMILES | CN(C)C1=NC[C@H](Cc2ccccc2)N1CCCC1CCCC1 |
| InChI | InChI=1S/C20H31N3/c1-22(2)20-21-16-19(15-18-11-4-3-5-12-18)23(20)14-8-13-17-9-6-7-10-17/h3-5,11-12,17,19H,6-10,13-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | ZVNDLOICJMWNOR-IBGZPJMESA-N |
| XLogP | 3.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine (CID 25102539) is (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine is CN(C)C1=NC[C@H](Cc2ccccc2)N1CCCC1CCCC1.
What is the InChIKey of (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
The InChIKey is ZVNDLOICJMWNOR-IBGZPJMESA-N. The full InChI is InChI=1S/C20H31N3/c1-22(2)20-21-16-19(15-18-11-4-3-5-12-18)23(20)14-8-13-17-9-6-7-10-17/h3-5,11-12,17,19H,6-10,13-16H2,1-2H3/t19-/m0/s1.
What are the key properties of (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
(5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine has a molecular weight of 313.49 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-benzyl-1-(3-cyclopentylpropyl)-N,N-dimethyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 25102539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).