About (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine
(5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine (PubChem CID 25102542) has the molecular formula C19H31N3
and a molecular weight of 301.48 g/mol. Its IUPAC name is (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 25102542 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCCCCCN1C(N(C)C)=NC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H31N3/c1-4-5-6-7-11-14-22-18(16-20-19(22)21(2)3)15-17-12-9-8-10-13-17/h8-10,12-13,18H,4-7,11,14-16H2,1-3H3/t18-/m0/s1 |
| InChIKey | KKKFHDJXPHSSGO-SFHVURJKSA-N |
| XLogP | 3.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine (CID 25102542) is (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine is CCCCCCCN1C(N(C)C)=NC[C@@H]1Cc1ccccc1.
What is the InChIKey of (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
The InChIKey is KKKFHDJXPHSSGO-SFHVURJKSA-N. The full InChI is InChI=1S/C19H31N3/c1-4-5-6-7-11-14-22-18(16-20-19(22)21(2)3)15-17-12-9-8-10-13-17/h8-10,12-13,18H,4-7,11,14-16H2,1-3H3/t18-/m0/s1.
What are the key properties of (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine?
(5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine has a molecular weight of 301.48 g/mol, XLogP of 3.80, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-benzyl-1-heptyl-N,N-dimethyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 25102542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).