C19H21N7O5 — CID 25102660
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide (PubChem CID 25102660) has the molecular formula C19H21N7O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 25102660 |
| Molecular Formula | C19H21N7O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methylacetamide |
| SMILES | Cc1nn(CC(=O)N(C)c2c(N)n(Cc3ccccc3)c(=O)[nH]c2=O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N7O5/c1-11-15(26(30)31)12(2)25(22-11)10-14(27)23(3)16-17(20)24(19(29)21-18(16)28)9-13-7-5-4-6-8-13/h4-8H,9-10,20H2,1-3H3,(H,21,28,29) |
| InChIKey | ZMAPUIBVAIIXMS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 162.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|