C18H16F2N6O2 — CID 25102686
N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-3-(tetrazol-1-yl)benzamide (PubChem CID 25102686) has the molecular formula C18H16F2N6O2 and a molecular weight of 386.36 g/mol. Its IUPAC name is N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25102686 |
| Molecular Formula | C18H16F2N6O2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-3-(tetrazol-1-yl)benzamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C18H16F2N6O2/c1-2-25(10-16(27)22-17-14(19)7-4-8-15(17)20)18(28)12-5-3-6-13(9-12)26-11-21-23-24-26/h3-9,11H,2,10H2,1H3,(H,22,27) |
| InChIKey | MZZWGTXCTZLNEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |