C27H24N2O4 — CID 25102698
(2R,11R,12R,13R)-5-methoxy-13-methyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-14,22-dione (PubChem CID 25102698) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (2R,11R,12R,13R)-5-methoxy-13-methyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-14,22-dione.
| Compound Name | (2R,11R,12R,13R)-5-methoxy-13-methyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-14,22-dione |
|---|---|
| PubChem CID | 25102698 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2R,11R,12R,13R)-5-methoxy-13-methyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-14,22-dione |
| SMILES | COc1ccc2c(c1)[C@H]1[C@H](CO2)[C@H](c2ccccc2)[C@]2(C)C(=O)Nc3ccccc3C(=O)N12 |
| InChI | InChI=1S/C27H24N2O4/c1-27-23(16-8-4-3-5-9-16)20-15-33-22-13-12-17(32-2)14-19(22)24(20)29(27)25(30)18-10-6-7-11-21(18)28-26(27)31/h3-14,20,23-24H,15H2,1-2H3,(H,28,31)/t20-,23+,24+,27-/m1/s1 |
| InChIKey | UKMYDTCZCMRANV-MBPYSEENSA-N |
| XLogP | 4.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |