C24H24N2O5 — CID 25102743
ethyl (2R,11R,12S,13R)-5,13-dimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-12-carboxylate (PubChem CID 25102743) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl (2R,11R,12S,13R)-5,13-dimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-12-carboxylate.
| Compound Name | ethyl (2R,11R,12S,13R)-5,13-dimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 25102743 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl (2R,11R,12S,13R)-5,13-dimethyl-14,22-dioxo-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16,18,20-hexaene-12-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2COc3ccc(C)cc3[C@@H]2N2C(=O)c3ccccc3NC(=O)[C@@]12C |
| InChI | InChI=1S/C24H24N2O5/c1-4-30-22(28)19-16-12-31-18-10-9-13(2)11-15(18)20(16)26-21(27)14-7-5-6-8-17(14)25-23(29)24(19,26)3/h5-11,16,19-20H,4,12H2,1-3H3,(H,25,29)/t16-,19-,20+,24-/m1/s1 |
| InChIKey | PNMPISHYQACPQD-AYFLJRIOSA-N |
| XLogP | 3.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |