C17H14Cl2N4O — CID 25102757
2,6-dichloro-4-(8-methoxy-3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline (PubChem CID 25102757) has the molecular formula C17H14Cl2N4O and a molecular weight of 361.23 g/mol. Its IUPAC name is 2,6-dichloro-4-(8-methoxy-3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline.
| Compound Name | 2,6-dichloro-4-(8-methoxy-3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline |
|---|---|
| PubChem CID | 25102757 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2,6-dichloro-4-(8-methoxy-3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline |
| SMILES | COc1ccc2c3n(nc2c1)CCN=C3c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N4O/c1-24-10-2-3-11-14(8-10)22-23-5-4-21-16(17(11)23)9-6-12(18)15(20)13(19)7-9/h2-3,6-8H,4-5,20H2,1H3 |
| InChIKey | YUBIBUIVAVMFFS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|