C25H28FNS2 — CID 25102835
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (E)-3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 25102835) has the molecular formula C25H28FNS2 and a molecular weight of 425.64 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (E)-3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (E)-3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 25102835 |
| Molecular Formula | C25H28FNS2 |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (E)-3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | Fc1ccc(S/C=C/C(=N\c2ccccc2)SC2CCC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C25H28FNS2/c26-21-11-14-23(15-12-21)28-17-16-25(27-22-8-2-1-3-9-22)29-24-13-10-19-6-4-5-7-20(19)18-24/h1-3,8-9,11-12,14-17,19-20,24H,4-7,10,13,18H2/b17-16+,27-25+ |
| InChIKey | ICCGHWAFRUQDPA-GLUPESANSA-N |
| XLogP | 8.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|