C14H17N3O2 — CID 25103066
N-cyclohexyl-N-methyl-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 25103066) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-cyclohexyl-N-methyl-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 25103066 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-cyclohexyl-N-methyl-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2nonc2c1)C1CCCCC1 |
| InChI | InChI=1S/C14H17N3O2/c1-17(11-5-3-2-4-6-11)14(18)10-7-8-12-13(9-10)16-19-15-12/h7-9,11H,2-6H2,1H3 |
| InChIKey | BLCBFBIJROUSPN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |