C27H28BrN5O2 — CID 25103251
1-[[4-[(4-benzylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 25103251) has the molecular formula C27H28BrN5O2 and a molecular weight of 534.46 g/mol. Its IUPAC name is 1-[[4-[(4-benzylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[[4-[(4-benzylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 25103251 |
| Molecular Formula | C27H28BrN5O2 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 1-[[4-[(4-benzylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(Nc2cc(CN3CCN(Cc4ccccc4)CC3)c3ccc(Br)cc3n2)C1=O |
| InChI | InChI=1S/C27H28BrN5O2/c1-18-19(2)27(35)33(26(18)34)30-25-14-21(23-9-8-22(28)15-24(23)29-25)17-32-12-10-31(11-13-32)16-20-6-4-3-5-7-20/h3-9,14-15H,10-13,16-17H2,1-2H3,(H,29,30) |
| InChIKey | BHIPOQYVODCYCR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|