C27H26BrN5O3 — CID 25103374
1-[[4-[(4-benzoylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 25103374) has the molecular formula C27H26BrN5O3 and a molecular weight of 548.44 g/mol. Its IUPAC name is 1-[[4-[(4-benzoylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[[4-[(4-benzoylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 25103374 |
| Molecular Formula | C27H26BrN5O3 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 1-[[4-[(4-benzoylpiperazin-1-yl)methyl]-7-bromoquinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(Nc2cc(CN3CCN(C(=O)c4ccccc4)CC3)c3ccc(Br)cc3n2)C1=O |
| InChI | InChI=1S/C27H26BrN5O3/c1-17-18(2)26(35)33(25(17)34)30-24-14-20(22-9-8-21(28)15-23(22)29-24)16-31-10-12-32(13-11-31)27(36)19-6-4-3-5-7-19/h3-9,14-15H,10-13,16H2,1-2H3,(H,29,30) |
| InChIKey | GTXTYYHXSNFRSM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|