C9H6F8O3 — CID 25103637
methyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate (PubChem CID 25103637) has the molecular formula C9H6F8O3 and a molecular weight of 314.13 g/mol. Its IUPAC name is methyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate.
| Compound Name | methyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 25103637 |
| Molecular Formula | C9H6F8O3 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | methyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H6F8O3/c1-19-4-3(5(18)20-2)6(10,11)8(14,15)9(16,17)7(4,12)13/h1-2H3 |
| InChIKey | NFADLOGNOWFEGJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|