C10H8F8O3 — CID 25103638
ethyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate (PubChem CID 25103638) has the molecular formula C10H8F8O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is ethyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate.
| Compound Name | ethyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 25103638 |
| Molecular Formula | C10H8F8O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | ethyl 3,3,4,4,5,5,6,6-octafluoro-2-methoxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(OC)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H8F8O3/c1-3-21-6(19)4-5(20-2)8(13,14)10(17,18)9(15,16)7(4,11)12/h3H2,1-2H3 |
| InChIKey | WGDGRWXVBXYJTD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|