C23H23N5O3 — CID 25104233
5-cyano-N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-1H-imidazole-2-carboxamide (PubChem CID 25104233) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-cyano-N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 25104233 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 5-cyano-N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-1H-imidazole-2-carboxamide |
| SMILES | CN1C(=O)CC(c2ccc(NC(=O)c3ncc(C#N)[nH]3)c(C3=CCCCC3)c2)CC1=O |
| InChI | InChI=1S/C23H23N5O3/c1-28-20(29)10-16(11-21(28)30)15-7-8-19(18(9-15)14-5-3-2-4-6-14)27-23(31)22-25-13-17(12-24)26-22/h5,7-9,13,16H,2-4,6,10-11H2,1H3,(H,25,26)(H,27,31) |
| InChIKey | ZJESLKXOBQREAT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|