C19H21ClF3N3O3 — CID 25104349
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-(5,5-dimethyl-3-oxohexyl)-4-methylpyrrole-2,5-dione (PubChem CID 25104349) has the molecular formula C19H21ClF3N3O3 and a molecular weight of 431.84 g/mol. Its IUPAC name is 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-(5,5-dimethyl-3-oxohexyl)-4-methylpyrrole-2,5-dione.
| Compound Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-(5,5-dimethyl-3-oxohexyl)-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 25104349 |
| Molecular Formula | C19H21ClF3N3O3 |
| Molecular Weight | 431.84 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-3-(5,5-dimethyl-3-oxohexyl)-4-methylpyrrole-2,5-dione |
| SMILES | CC1=C(CCC(=O)CC(C)(C)C)C(=O)N(Nc2ccc(C(F)(F)F)c(Cl)n2)C1=O |
| InChI | InChI=1S/C19H21ClF3N3O3/c1-10-12(6-5-11(27)9-18(2,3)4)17(29)26(16(10)28)25-14-8-7-13(15(20)24-14)19(21,22)23/h7-8H,5-6,9H2,1-4H3,(H,24,25) |
| InChIKey | YKBBTFJXZGXYTA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|