C29H42O7 — CID 25104423
(1R,7S,8S,10S,12S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-3-(4-methyloxan-2-yl)prop-2-enyl]-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 25104423) has the molecular formula C29H42O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is (1R,7S,8S,10S,12S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-3-(4-methyloxan-2-yl)prop-2-enyl]-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (1R,7S,8S,10S,12S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-3-(4-methyloxan-2-yl)prop-2-enyl]-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 25104423 |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (1R,7S,8S,10S,12S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-3-(4-methyloxan-2-yl)prop-2-enyl]-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CCC[C@@H]2CC=C[C@@H](C/C=C/C(=O)O[C@H]([C@@H](O)/C=C/C3CC(C)CCO3)C[C@@H]3O[C@H]3[C@@H](O)C1)O2 |
| InChI | InChI=1S/C29H42O7/c1-19-6-3-7-21-8-4-9-22(34-21)10-5-11-28(32)35-26(18-27-29(36-27)25(31)17-19)24(30)13-12-23-16-20(2)14-15-33-23/h4-5,9,11-13,20-27,29-31H,1,3,6-8,10,14-18H2,2H3/b11-5+,13-12+/t20?,21-,22+,23?,24+,25+,26+,27+,29+/m1/s1 |
| InChIKey | JUABONSBRVAQLB-ZIPIYYRBSA-N |
| XLogP | 3.94 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|